C17H19NO2S — CID 124882449
(1R,2S)-2-[(2R)-2-thiophen-2-ylmorpholin-4-yl]-2,3-dihydro-1H-inden-1-ol (PubChem CID 124882449) has the molecular formula C17H19NO2S and a molecular weight of 301.41 g/mol. Its IUPAC name is (1R,2S)-2-[(2R)-2-thiophen-2-ylmorpholin-4-yl]-2,3-dihydro-1H-inden-1-ol.
| Compound Name | (1R,2S)-2-[(2R)-2-thiophen-2-ylmorpholin-4-yl]-2,3-dihydro-1H-inden-1-ol |
|---|---|
| PubChem CID | 124882449 |
| Molecular Formula | C17H19NO2S |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | (1R,2S)-2-[(2R)-2-thiophen-2-ylmorpholin-4-yl]-2,3-dihydro-1H-inden-1-ol |
| SMILES | O[C@@H]1c2ccccc2C[C@@H]1N1CCO[C@@H](c2cccs2)C1 |
| InChI | InChI=1S/C17H19NO2S/c19-17-13-5-2-1-4-12(13)10-14(17)18-7-8-20-15(11-18)16-6-3-9-21-16/h1-6,9,14-15,17,19H,7-8,10-11H2/t14-,15+,17+/m0/s1 |
| InChIKey | VNKXAHRQWAOWOL-ZMSDIMECSA-N |
| XLogP | 2.78 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |