C17H21N5O3 — CID 124884294
1-[(5S,9S)-2,6-dioxaspiro[4.5]decan-9-yl]-3-[4-(triazol-1-yl)phenyl]urea (PubChem CID 124884294) has the molecular formula C17H21N5O3 and a molecular weight of 343.39 g/mol. Its IUPAC name is 1-[(5S,9S)-2,6-dioxaspiro[4.5]decan-9-yl]-3-[4-(triazol-1-yl)phenyl]urea.
| Compound Name | 1-[(5S,9S)-2,6-dioxaspiro[4.5]decan-9-yl]-3-[4-(triazol-1-yl)phenyl]urea |
|---|---|
| PubChem CID | 124884294 |
| Molecular Formula | C17H21N5O3 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.16 |
| IUPAC Name | 1-[(5S,9S)-2,6-dioxaspiro[4.5]decan-9-yl]-3-[4-(triazol-1-yl)phenyl]urea |
| SMILES | O=C(Nc1ccc(-n2ccnn2)cc1)N[C@H]1CCO[C@]2(CCOC2)C1 |
| InChI | InChI=1S/C17H21N5O3/c23-16(20-14-5-9-25-17(11-14)6-10-24-12-17)19-13-1-3-15(4-2-13)22-8-7-18-21-22/h1-4,7-8,14H,5-6,9-12H2,(H2,19,20,23)/t14-,17+/m0/s1 |
| InChIKey | RBNWSWDRELJIQK-WMLDXEAASA-N |
| XLogP | 1.73 |
| TPSA | 90.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |