C18H24N4O3 — CID 127605403
1-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-(4-methyl-1H-indazol-7-yl)urea (PubChem CID 127605403) has the molecular formula C18H24N4O3 and a molecular weight of 344.42 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-(4-methyl-1H-indazol-7-yl)urea.
| Compound Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-(4-methyl-1H-indazol-7-yl)urea |
|---|---|
| PubChem CID | 127605403 |
| Molecular Formula | C18H24N4O3 |
| Molecular Weight | 344.42 g/mol |
| Exact Mass | 344.18 |
| IUPAC Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-3-(4-methyl-1H-indazol-7-yl)urea |
| SMILES | Cc1ccc(NC(=O)NC2CCOC3(CCOCC3)C2)c2[nH]ncc12 |
| InChI | InChI=1S/C18H24N4O3/c1-12-2-3-15(16-14(12)11-19-22-16)21-17(23)20-13-4-7-25-18(10-13)5-8-24-9-6-18/h2-3,11,13H,4-10H2,1H3,(H,19,22)(H2,20,21,23) |
| InChIKey | QDXFFYQKQJIIFR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 88.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.42 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |