C14H17FN2O2 — CID 124886032
4-fluoro-N-[(3S)-3-propyloxolan-3-yl]-1,3-benzoxazol-2-amine (PubChem CID 124886032) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is 4-fluoro-N-[(3S)-3-propyloxolan-3-yl]-1,3-benzoxazol-2-amine.
| Compound Name | 4-fluoro-N-[(3S)-3-propyloxolan-3-yl]-1,3-benzoxazol-2-amine |
|---|---|
| PubChem CID | 124886032 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 4-fluoro-N-[(3S)-3-propyloxolan-3-yl]-1,3-benzoxazol-2-amine |
| SMILES | CCC[C@]1(Nc2nc3c(F)cccc3o2)CCOC1 |
| InChI | InChI=1S/C14H17FN2O2/c1-2-6-14(7-8-18-9-14)17-13-16-12-10(15)4-3-5-11(12)19-13/h3-5H,2,6-9H2,1H3,(H,16,17)/t14-/m0/s1 |
| InChIKey | DLOXMJKHIUFEBX-AWEZNQCLSA-N |
| XLogP | 3.34 |
| TPSA | 47.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |