C22H23N5O2 — CID 124907828
8-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(1H-pyrazol-5-yl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione (PubChem CID 124907828) has the molecular formula C22H23N5O2 and a molecular weight of 389.46 g/mol. Its IUPAC name is 8-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(1H-pyrazol-5-yl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione.
| Compound Name | 8-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(1H-pyrazol-5-yl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione |
|---|---|
| PubChem CID | 124907828 |
| Molecular Formula | C22H23N5O2 |
| Molecular Weight | 389.46 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | 8-[(1R,2S,3R)-2,3-dimethylcyclohexyl]-2-(1H-pyrazol-5-yl)pyrido[4,3-b][1,6]naphthyridine-1,9-dione |
| SMILES | C[C@H]1[C@H](C)CCC[C@H]1n1ccc2nc3ccn(-c4ccn[nH]4)c(=O)c3cc2c1=O |
| InChI | InChI=1S/C22H23N5O2/c1-13-4-3-5-19(14(13)2)26-10-7-17-15(21(26)28)12-16-18(24-17)8-11-27(22(16)29)20-6-9-23-25-20/h6-14,19H,3-5H2,1-2H3,(H,23,25)/t13-,14+,19-/m1/s1 |
| InChIKey | GMBJHBDZXWAQAP-BIENJYKASA-N |
| XLogP | 3.42 |
| TPSA | 85.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.46 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|