C13H19NO — CID 124910879
(1S,2S,5R,8S)-1,2,5,6,7,8-hexamethyl-4-azatricyclo[3.3.0.02,8]oct-6-en-3-one (PubChem CID 124910879) has the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. Its IUPAC name is (1S,2S,5R,8S)-1,2,5,6,7,8-hexamethyl-4-azatricyclo[3.3.0.02,8]oct-6-en-3-one.
| Compound Name | (1S,2S,5R,8S)-1,2,5,6,7,8-hexamethyl-4-azatricyclo[3.3.0.02,8]oct-6-en-3-one |
|---|---|
| PubChem CID | 124910879 |
| Molecular Formula | C13H19NO |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.15 |
| IUPAC Name | (1S,2S,5R,8S)-1,2,5,6,7,8-hexamethyl-4-azatricyclo[3.3.0.02,8]oct-6-en-3-one |
| SMILES | CC1=C(C)[C@@]2(C)NC(=O)[C@@]3(C)[C@]1(C)[C@@]32C |
| InChI | InChI=1S/C13H19NO/c1-7-8(2)12(5)13(6)10(7,3)11(13,4)9(15)14-12/h1-6H3,(H,14,15)/t10-,11+,12-,13+/m1/s1 |
| InChIKey | DAMHKCOHRUYAPL-XQHKEYJVSA-N |
| XLogP | 2.26 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|