C16H22N6 — CID 124945346
(1S,4R,9S,10R)-10-methyl-12-(7H-purin-6-yl)-3,12-diazatricyclo[7.2.1.04,10]dodecane (PubChem CID 124945346) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is (1S,4R,9S,10R)-10-methyl-12-(7H-purin-6-yl)-3,12-diazatricyclo[7.2.1.04,10]dodecane.
| Compound Name | (1S,4R,9S,10R)-10-methyl-12-(7H-purin-6-yl)-3,12-diazatricyclo[7.2.1.04,10]dodecane |
|---|---|
| PubChem CID | 124945346 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (1S,4R,9S,10R)-10-methyl-12-(7H-purin-6-yl)-3,12-diazatricyclo[7.2.1.04,10]dodecane |
| SMILES | C[C@@]12C[C@H]3CN[C@@H]1CCCC[C@@H]2N3c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C16H22N6/c1-16-6-10-7-17-11(16)4-2-3-5-12(16)22(10)15-13-14(19-8-18-13)20-9-21-15/h8-12,17H,2-7H2,1H3,(H,18,19,20,21)/t10-,11+,12-,16+/m0/s1 |
| InChIKey | BQHFXUXBMCXLLD-MEQWQQMJSA-N |
| XLogP | 1.85 |
| TPSA | 69.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |