C16H22N6 — CID 155987183
(1S,4R,9R)-3,9-dimethyl-11-(7H-purin-6-yl)-3,11-diazatricyclo[6.2.1.04,9]undecane (PubChem CID 155987183) has the molecular formula C16H22N6 and a molecular weight of 298.39 g/mol. Its IUPAC name is (1S,4R,9R)-3,9-dimethyl-11-(7H-purin-6-yl)-3,11-diazatricyclo[6.2.1.04,9]undecane.
| Compound Name | (1S,4R,9R)-3,9-dimethyl-11-(7H-purin-6-yl)-3,11-diazatricyclo[6.2.1.04,9]undecane |
|---|---|
| PubChem CID | 155987183 |
| Molecular Formula | C16H22N6 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (1S,4R,9R)-3,9-dimethyl-11-(7H-purin-6-yl)-3,11-diazatricyclo[6.2.1.04,9]undecane |
| SMILES | CN1C[C@@H]2C[C@@]3(C)C(CCC[C@@H]13)N2c1ncnc2nc[nH]c12 |
| InChI | InChI=1S/C16H22N6/c1-16-6-10-7-21(2)11(16)4-3-5-12(16)22(10)15-13-14(18-8-17-13)19-9-20-15/h8-12H,3-7H2,1-2H3,(H,17,18,19,20)/t10-,11+,12?,16+/m0/s1 |
| InChIKey | KHEOKTNGVJDMEO-QFFPRFPISA-N |
| XLogP | 1.80 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |