C23H28N6 — CID 155987262
(1S,2S,4R,9S)-2-benzyl-9,11-dimethyl-3-(7H-purin-6-yl)-3,11-diazatricyclo[6.2.1.04,9]undecane (PubChem CID 155987262) has the molecular formula C23H28N6 and a molecular weight of 388.52 g/mol. Its IUPAC name is (1S,2S,4R,9S)-2-benzyl-9,11-dimethyl-3-(7H-purin-6-yl)-3,11-diazatricyclo[6.2.1.04,9]undecane.
| Compound Name | (1S,2S,4R,9S)-2-benzyl-9,11-dimethyl-3-(7H-purin-6-yl)-3,11-diazatricyclo[6.2.1.04,9]undecane |
|---|---|
| PubChem CID | 155987262 |
| Molecular Formula | C23H28N6 |
| Molecular Weight | 388.52 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | (1S,2S,4R,9S)-2-benzyl-9,11-dimethyl-3-(7H-purin-6-yl)-3,11-diazatricyclo[6.2.1.04,9]undecane |
| SMILES | CN1C2CCC[C@H]3N(c4ncnc5nc[nH]c45)[C@@H](Cc4ccccc4)[C@@H]1C[C@@]23C |
| InChI | InChI=1S/C23H28N6/c1-23-12-17-16(11-15-7-4-3-5-8-15)29(19(23)10-6-9-18(23)28(17)2)22-20-21(25-13-24-20)26-14-27-22/h3-5,7-8,13-14,16-19H,6,9-12H2,1-2H3,(H,24,25,26,27)/t16-,17-,18?,19+,23-/m0/s1 |
| InChIKey | SAALJXHXJRLJHV-JJLJJILPSA-N |
| XLogP | 3.42 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.52 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |