C16H22N4O — CID 110140178
[(1S,4R,9S,10R)-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-pyridazin-3-ylmethanone (PubChem CID 110140178) has the molecular formula C16H22N4O and a molecular weight of 286.38 g/mol. Its IUPAC name is [(1S,4R,9S,10R)-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-pyridazin-3-ylmethanone.
| Compound Name | [(1S,4R,9S,10R)-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-pyridazin-3-ylmethanone |
|---|---|
| PubChem CID | 110140178 |
| Molecular Formula | C16H22N4O |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | [(1S,4R,9S,10R)-10-methyl-3,12-diazatricyclo[7.2.1.04,10]dodecan-12-yl]-pyridazin-3-ylmethanone |
| SMILES | C[C@@]12C[C@H]3CN[C@@H]1CCCC[C@@H]2N3C(=O)c1cccnn1 |
| InChI | InChI=1S/C16H22N4O/c1-16-9-11-10-17-13(16)6-2-3-7-14(16)20(11)15(21)12-5-4-8-18-19-12/h4-5,8,11,13-14,17H,2-3,6-7,9-10H2,1H3/t11-,13+,14-,16+/m0/s1 |
| InChIKey | JXEVQHPKBBJYPZ-ZGMNHVEMSA-N |
| XLogP | 1.61 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |