C25H38N2O3 — CID 124953574
N-[(1S,5S,6S,8R,10S)-5-[4-(diethylamino)-2-methoxyphenyl]-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide (PubChem CID 124953574) has the molecular formula C25H38N2O3 and a molecular weight of 414.59 g/mol. Its IUPAC name is N-[(1S,5S,6S,8R,10S)-5-[4-(diethylamino)-2-methoxyphenyl]-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide.
| Compound Name | N-[(1S,5S,6S,8R,10S)-5-[4-(diethylamino)-2-methoxyphenyl]-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide |
|---|---|
| PubChem CID | 124953574 |
| Molecular Formula | C25H38N2O3 |
| Molecular Weight | 414.59 g/mol |
| Exact Mass | 414.29 |
| IUPAC Name | N-[(1S,5S,6S,8R,10S)-5-[4-(diethylamino)-2-methoxyphenyl]-9,9-dimethyl-4-oxatricyclo[6.2.1.01,6]undecan-10-yl]acetamide |
| SMILES | CCN(CC)c1ccc([C@H]2OCC[C@@]34C[C@@H](C[C@H]23)C(C)(C)[C@@H]4NC(C)=O)c(OC)c1 |
| InChI | InChI=1S/C25H38N2O3/c1-7-27(8-2)18-9-10-19(21(14-18)29-6)22-20-13-17-15-25(20,11-12-30-22)23(24(17,4)5)26-16(3)28/h9-10,14,17,20,22-23H,7-8,11-13,15H2,1-6H3,(H,26,28)/t17-,20-,22-,23+,25-/m1/s1 |
| InChIKey | DWCRTWPKXIMTAB-ZGDIDTHXSA-N |
| XLogP | 4.56 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.59 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |