C14H18FN3O4S — CID 124986027
(6R)-1-acetyl-4-(2-fluorophenyl)sulfonyl-1,4-diazepane-6-carboxamide (PubChem CID 124986027) has the molecular formula C14H18FN3O4S and a molecular weight of 343.38 g/mol. Its IUPAC name is (6R)-1-acetyl-4-(2-fluorophenyl)sulfonyl-1,4-diazepane-6-carboxamide.
| Compound Name | (6R)-1-acetyl-4-(2-fluorophenyl)sulfonyl-1,4-diazepane-6-carboxamide |
|---|---|
| PubChem CID | 124986027 |
| Molecular Formula | C14H18FN3O4S |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.10 |
| IUPAC Name | (6R)-1-acetyl-4-(2-fluorophenyl)sulfonyl-1,4-diazepane-6-carboxamide |
| SMILES | CC(=O)N1CCN(S(=O)(=O)c2ccccc2F)C[C@H](C(N)=O)C1 |
| InChI | InChI=1S/C14H18FN3O4S/c1-10(19)17-6-7-18(9-11(8-17)14(16)20)23(21,22)13-5-3-2-4-12(13)15/h2-5,11H,6-9H2,1H3,(H2,16,20)/t11-/m1/s1 |
| InChIKey | NVUAHPGGCDDZNE-LLVKDONJSA-N |
| XLogP | -0.22 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |