C21H30N6O3S — CID 124989172
N-[4-(4-methylpiperazin-1-yl)phenyl]-2-[(2R)-2-(4-methylsulfonyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]acetamide (PubChem CID 124989172) has the molecular formula C21H30N6O3S and a molecular weight of 446.58 g/mol. Its IUPAC name is N-[4-(4-methylpiperazin-1-yl)phenyl]-2-[(2R)-2-(4-methylsulfonyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]acetamide.
| Compound Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-[(2R)-2-(4-methylsulfonyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]acetamide |
|---|---|
| PubChem CID | 124989172 |
| Molecular Formula | C21H30N6O3S |
| Molecular Weight | 446.58 g/mol |
| Exact Mass | 446.21 |
| IUPAC Name | N-[4-(4-methylpiperazin-1-yl)phenyl]-2-[(2R)-2-(4-methylsulfonyl-1H-pyrazol-5-yl)pyrrolidin-1-yl]acetamide |
| SMILES | CN1CCN(c2ccc(NC(=O)CN3CCC[C@@H]3c3[nH]ncc3S(C)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C21H30N6O3S/c1-25-10-12-26(13-11-25)17-7-5-16(6-8-17)23-20(28)15-27-9-3-4-18(27)21-19(14-22-24-21)31(2,29)30/h5-8,14,18H,3-4,9-13,15H2,1-2H3,(H,22,24)(H,23,28)/t18-/m1/s1 |
| InChIKey | OSKDQHCUQSIONI-GOSISDBHSA-N |
| XLogP | 1.34 |
| TPSA | 101.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.58 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|