C16H24 — CID 12502275
(1E,3E,5Z,7Z)-1,3-ditert-butylcycloocta-1,3,5,7-tetraene (PubChem CID 12502275) has the molecular formula C16H24 and a molecular weight of 216.37 g/mol. Its IUPAC name is (1E,3E,5Z,7Z)-1,3-ditert-butylcycloocta-1,3,5,7-tetraene.
| Compound Name | (1E,3E,5Z,7Z)-1,3-ditert-butylcycloocta-1,3,5,7-tetraene |
|---|---|
| PubChem CID | 12502275 |
| Molecular Formula | C16H24 |
| Molecular Weight | 216.37 g/mol |
| Exact Mass | 216.19 |
| IUPAC Name | (1E,3E,5Z,7Z)-1,3-ditert-butylcycloocta-1,3,5,7-tetraene |
| SMILES | CC(C)(C)C1=C/C(C(C)(C)C)=C\C=C/C=C\1 |
| InChI | InChI=1S/C16H24/c1-15(2,3)13-10-8-7-9-11-14(12-13)16(4,5)6/h7-12H,1-6H3/b8-7-,9-7-,10-8-,11-9-,13-10+,13-12+,14-11+,14-12+ |
| InChIKey | RSCBOFFMFWKJQS-RIQKGKCOSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.37 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |