C14H24N2O — CID 125027482
(NZ)-N-[(1S,3R,4S)-3-[(2R)-2-ethylpiperidin-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 125027482) has the molecular formula C14H24N2O and a molecular weight of 236.36 g/mol. Its IUPAC name is (NZ)-N-[(1S,3R,4S)-3-[(2R)-2-ethylpiperidin-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1S,3R,4S)-3-[(2R)-2-ethylpiperidin-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
|---|---|
| PubChem CID | 125027482 |
| Molecular Formula | C14H24N2O |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.19 |
| IUPAC Name | (NZ)-N-[(1S,3R,4S)-3-[(2R)-2-ethylpiperidin-1-yl]-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | CC[C@@H]1CCCCN1[C@H]1/C(=N\O)[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C14H24N2O/c1-2-12-5-3-4-8-16(12)14-11-7-6-10(9-11)13(14)15-17/h10-12,14,17H,2-9H2,1H3/b15-13-/t10-,11-,12+,14+/m0/s1 |
| InChIKey | FVJURVRWXRJNLR-GCZVIEPLSA-N |
| XLogP | 2.88 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|