C14H24N2O2 — CID 125027521
2-[(2S)-1-[(1S,2S,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperidin-2-yl]ethanol (PubChem CID 125027521) has the molecular formula C14H24N2O2 and a molecular weight of 252.36 g/mol. Its IUPAC name is 2-[(2S)-1-[(1S,2S,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperidin-2-yl]ethanol.
| Compound Name | 2-[(2S)-1-[(1S,2S,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperidin-2-yl]ethanol |
|---|---|
| PubChem CID | 125027521 |
| Molecular Formula | C14H24N2O2 |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.18 |
| IUPAC Name | 2-[(2S)-1-[(1S,2S,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperidin-2-yl]ethanol |
| SMILES | OCC[C@@H]1CCCCN1[C@@H]1/C(=N\O)[C@H]2CC[C@H]1C2 |
| InChI | InChI=1S/C14H24N2O2/c17-8-6-12-3-1-2-7-16(12)14-11-5-4-10(9-11)13(14)15-18/h10-12,14,17-18H,1-9H2/b15-13-/t10-,11-,12-,14-/m0/s1 |
| InChIKey | VUNZXGNWQTWYDB-BGVZYJBKSA-N |
| XLogP | 1.85 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|