C13H22N2O2 — CID 26975030
[(2R)-1-[(1R,2R,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperidin-2-yl]methanol (PubChem CID 26975030) has the molecular formula C13H22N2O2 and a molecular weight of 238.33 g/mol. Its IUPAC name is [(2R)-1-[(1R,2R,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperidin-2-yl]methanol.
| Compound Name | [(2R)-1-[(1R,2R,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperidin-2-yl]methanol |
|---|---|
| PubChem CID | 26975030 |
| Molecular Formula | C13H22N2O2 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.17 |
| IUPAC Name | [(2R)-1-[(1R,2R,3Z,4S)-3-hydroxyimino-2-bicyclo[2.2.1]heptanyl]piperidin-2-yl]methanol |
| SMILES | OC[C@H]1CCCCN1[C@H]1/C(=N\O)[C@H]2CC[C@@H]1C2 |
| InChI | InChI=1S/C13H22N2O2/c16-8-11-3-1-2-6-15(11)13-10-5-4-9(7-10)12(13)14-17/h9-11,13,16-17H,1-8H2/b14-12-/t9-,10+,11+,13+/m0/s1 |
| InChIKey | NNCGJXHCTDUHAH-CQDRTBHBSA-N |
| XLogP | 1.46 |
| TPSA | 56.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|