C15H18N2O2 — CID 125034009
(NZ)-N-[(1S,3R,5R,6E,7R,8S,9S,10S,11R)-6-hydroxyimino-4-propan-2-ylidene-2-pentacyclo[5.4.1.03,10.05,9.08,11]dodecanylidene]hydroxylamine (PubChem CID 125034009) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (NZ)-N-[(1S,3R,5R,6E,7R,8S,9S,10S,11R)-6-hydroxyimino-4-propan-2-ylidene-2-pentacyclo[5.4.1.03,10.05,9.08,11]dodecanylidene]hydroxylamine.
| Compound Name | (NZ)-N-[(1S,3R,5R,6E,7R,8S,9S,10S,11R)-6-hydroxyimino-4-propan-2-ylidene-2-pentacyclo[5.4.1.03,10.05,9.08,11]dodecanylidene]hydroxylamine |
|---|---|
| PubChem CID | 125034009 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (NZ)-N-[(1S,3R,5R,6E,7R,8S,9S,10S,11R)-6-hydroxyimino-4-propan-2-ylidene-2-pentacyclo[5.4.1.03,10.05,9.08,11]dodecanylidene]hydroxylamine |
| SMILES | CC(C)=C1[C@@H]2/C(=N\O)[C@H]3C[C@H]4/C(=N\O)[C@@H]1[C@@H]1[C@@H]2[C@H]3[C@@H]14 |
| InChI | InChI=1S/C15H18N2O2/c1-4(2)7-12-10-8-5(14(12)16-18)3-6-9(8)11(10)13(7)15(6)17-19/h5-6,8-13,18-19H,3H2,1-2H3/b16-14-,17-15+/t5-,6+,8+,9-,10-,11-,12-,13-/m0/s1 |
| InChIKey | GRWBLDDRWOQNMD-JNPAOSDKSA-N |
| XLogP | 2.37 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|