C15H25NO — CID 134204519
N-[5-(2,2-dimethylpropyl)-2-adamantylidene]hydroxylamine (PubChem CID 134204519) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is N-[5-(2,2-dimethylpropyl)-2-adamantylidene]hydroxylamine.
| Compound Name | N-[5-(2,2-dimethylpropyl)-2-adamantylidene]hydroxylamine |
|---|---|
| PubChem CID | 134204519 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | N-[5-(2,2-dimethylpropyl)-2-adamantylidene]hydroxylamine |
| SMILES | CC(C)(C)CC12CC3CC(C1)C(=NO)C(C3)C2 |
| InChI | InChI=1S/C15H25NO/c1-14(2,3)9-15-6-10-4-11(7-15)13(16-17)12(5-10)8-15/h10-12,17H,4-9H2,1-3H3/b16-13- |
| InChIKey | MLANWSZLQNEDRC-SSZFMOIBSA-N |
| XLogP | 4.08 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|