C17H32N+ — CID 7471211
1-adamantylmethyl-(2,2-dimethylpropyl)-methylazanium (PubChem CID 7471211) has the molecular formula C17H32N+ and a molecular weight of 250.45 g/mol. Its IUPAC name is 1-adamantylmethyl-(2,2-dimethylpropyl)-methylazanium.
| Compound Name | 1-adamantylmethyl-(2,2-dimethylpropyl)-methylazanium |
|---|---|
| PubChem CID | 7471211 |
| Molecular Formula | C17H32N+ |
| Molecular Weight | 250.45 g/mol |
| Exact Mass | 250.25 |
| IUPAC Name | 1-adamantylmethyl-(2,2-dimethylpropyl)-methylazanium |
| SMILES | C[NH+](CC(C)(C)C)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C17H31N/c1-16(2,3)11-18(4)12-17-8-13-5-14(9-17)7-15(6-13)10-17/h13-15H,5-12H2,1-4H3/p+1 |
| InChIKey | YAQLVFBVTMVAOW-UHFFFAOYSA-O |
| XLogP | 2.76 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.45 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |