C13H11NO — CID 125036021
(2S,3S,4R,6R)-8-methoxytetracyclo[5.4.0.02,4.03,6]undeca-1(7),8,10-triene-4-carbonitrile (PubChem CID 125036021) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is (2S,3S,4R,6R)-8-methoxytetracyclo[5.4.0.02,4.03,6]undeca-1(7),8,10-triene-4-carbonitrile.
| Compound Name | (2S,3S,4R,6R)-8-methoxytetracyclo[5.4.0.02,4.03,6]undeca-1(7),8,10-triene-4-carbonitrile |
|---|---|
| PubChem CID | 125036021 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (2S,3S,4R,6R)-8-methoxytetracyclo[5.4.0.02,4.03,6]undeca-1(7),8,10-triene-4-carbonitrile |
| SMILES | COc1cccc2c1[C@@H]1C[C@@]3(C#N)[C@@H]1[C@@H]23 |
| InChI | InChI=1S/C13H11NO/c1-15-9-4-2-3-7-10(9)8-5-13(6-14)11(7)12(8)13/h2-4,8,11-12H,5H2,1H3/t8-,11+,12-,13-/m0/s1 |
| InChIKey | SUWKNWGRJKHXTG-MHNYQROPSA-N |
| XLogP | 2.42 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |