C11H18N2 — CID 125062456
(4S,6R)-5-ethyl-4,6-dimethyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine (PubChem CID 125062456) has the molecular formula C11H18N2 and a molecular weight of 178.28 g/mol. Its IUPAC name is (4S,6R)-5-ethyl-4,6-dimethyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine.
| Compound Name | (4S,6R)-5-ethyl-4,6-dimethyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 125062456 |
| Molecular Formula | C11H18N2 |
| Molecular Weight | 178.28 g/mol |
| Exact Mass | 178.15 |
| IUPAC Name | (4S,6R)-5-ethyl-4,6-dimethyl-1,4,6,7-tetrahydropyrrolo[3,2-c]pyridine |
| SMILES | CCN1[C@H](C)Cc2[nH]ccc2[C@@H]1C |
| InChI | InChI=1S/C11H18N2/c1-4-13-8(2)7-11-10(9(13)3)5-6-12-11/h5-6,8-9,12H,4,7H2,1-3H3/t8-,9+/m1/s1 |
| InChIKey | WIOQZWZXRPTPGU-BDAKNGLRSA-N |
| XLogP | 2.34 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.28 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |