C9H12N2 — CID 133168563
6-ethyl-6,7-dihydro-1H-pyrrolo[3,2-c]pyridine (PubChem CID 133168563) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 6-ethyl-6,7-dihydro-1H-pyrrolo[3,2-c]pyridine.
| Compound Name | 6-ethyl-6,7-dihydro-1H-pyrrolo[3,2-c]pyridine |
|---|---|
| PubChem CID | 133168563 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 6-ethyl-6,7-dihydro-1H-pyrrolo[3,2-c]pyridine |
| SMILES | CCC1Cc2[nH]ccc2C=N1 |
| InChI | InChI=1S/C9H12N2/c1-2-8-5-9-7(6-11-8)3-4-10-9/h3-4,6,8,10H,2,5H2,1H3 |
| InChIKey | GOMHKILLDVBGQT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |