C7H6N2O — CID 140615598
1,7-dihydropyrrolo[3,2-c]pyridin-6-one (PubChem CID 140615598) has the molecular formula C7H6N2O and a molecular weight of 134.14 g/mol. Its IUPAC name is 1,7-dihydropyrrolo[3,2-c]pyridin-6-one.
| Compound Name | 1,7-dihydropyrrolo[3,2-c]pyridin-6-one |
|---|---|
| PubChem CID | 140615598 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 1,7-dihydropyrrolo[3,2-c]pyridin-6-one |
| SMILES | O=C1Cc2[nH]ccc2C=N1 |
| InChI | InChI=1S/C7H6N2O/c10-7-3-6-5(4-9-7)1-2-8-6/h1-2,4,8H,3H2 |
| InChIKey | SWZKPHHUPAWLDN-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |