About 1,6-dihydropyrrolo[3,2-b]pyridin-5-one
1,6-dihydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 137253734) has the molecular formula C7H6N2O
and a molecular weight of 134.14 g/mol. Its IUPAC name is 1,6-dihydropyrrolo[3,2-b]pyridin-5-one.
Molecular Properties
| Compound Name | 1,6-dihydropyrrolo[3,2-b]pyridin-5-one |
| PubChem CID | 137253734 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 1,6-dihydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | O=C1CC=c2[nH]ccc2=N1 |
| InChI | InChI=1S/C7H6N2O/c10-7-2-1-5-6(9-7)3-4-8-5/h1,3-4,8H,2H2 |
| InChIKey | VZUKCCUXLDVOJR-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,6-dihydropyrrolo[3,2-b]pyridin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-dihydropyrrolo[3,2-b]pyridin-5-one?
The IUPAC name of 1,6-dihydropyrrolo[3,2-b]pyridin-5-one (CID 137253734) is 1,6-dihydropyrrolo[3,2-b]pyridin-5-one.
What is the SMILES notation for 1,6-dihydropyrrolo[3,2-b]pyridin-5-one?
The canonical SMILES for 1,6-dihydropyrrolo[3,2-b]pyridin-5-one is O=C1CC=c2[nH]ccc2=N1.
What is the InChIKey of 1,6-dihydropyrrolo[3,2-b]pyridin-5-one?
The InChIKey is VZUKCCUXLDVOJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N2O/c10-7-2-1-5-6(9-7)3-4-8-5/h1,3-4,8H,2H2.
What are the key properties of 1,6-dihydropyrrolo[3,2-b]pyridin-5-one?
1,6-dihydropyrrolo[3,2-b]pyridin-5-one has a molecular weight of 134.14 g/mol, XLogP of -0.65, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-dihydropyrrolo[3,2-b]pyridin-5-one is sourced from PubChem (CID 137253734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).