C7H6N2O — CID 137253734
1,6-dihydropyrrolo[3,2-b]pyridin-5-one (PubChem CID 137253734) has the molecular formula C7H6N2O and a molecular weight of 134.14 g/mol. Its IUPAC name is 1,6-dihydropyrrolo[3,2-b]pyridin-5-one.
| Compound Name | 1,6-dihydropyrrolo[3,2-b]pyridin-5-one |
|---|---|
| PubChem CID | 137253734 |
| Molecular Formula | C7H6N2O |
| Molecular Weight | 134.14 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 1,6-dihydropyrrolo[3,2-b]pyridin-5-one |
| SMILES | O=C1CC=c2[nH]ccc2=N1 |
| InChI | InChI=1S/C7H6N2O/c10-7-2-1-5-6(9-7)3-4-8-5/h1,3-4,8H,2H2 |
| InChIKey | VZUKCCUXLDVOJR-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 134.14 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |