C8H8N2O — CID 136626051
3,6-dihydro-2H-1,6-naphthyridin-5-one (PubChem CID 136626051) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 3,6-dihydro-2H-1,6-naphthyridin-5-one.
| Compound Name | 3,6-dihydro-2H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 136626051 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 3,6-dihydro-2H-1,6-naphthyridin-5-one |
| SMILES | O=c1[nH]ccc2c1=CCCN=2 |
| InChI | InChI=1S/C8H8N2O/c11-8-6-2-1-4-9-7(6)3-5-10-8/h2-3,5H,1,4H2,(H,10,11) |
| InChIKey | IQEDZTNMFZXGIR-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 45.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |