C6H7N3 — CID 45080239
4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine (PubChem CID 45080239) has the molecular formula C6H7N3 and a molecular weight of 121.14 g/mol. Its IUPAC name is 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine.
| Compound Name | 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine |
|---|---|
| PubChem CID | 45080239 |
| Molecular Formula | C6H7N3 |
| Molecular Weight | 121.14 g/mol |
| Exact Mass | 121.06 |
| IUPAC Name | 4,5-dihydro-1H-pyrrolo[3,2-d]pyrimidine |
| SMILES | C1=NCc2[nH]ccc2N1 |
| InChI | InChI=1S/C6H7N3/c1-2-8-6-3-7-4-9-5(1)6/h1-2,4,8H,3H2,(H,7,9) |
| InChIKey | KECHYONWBSYJMB-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 121.14 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |