C20H23N — CID 134425777
3-ethyl-7-methyl-6-(2-phenylethyl)-3,4-dihydroisoquinoline (PubChem CID 134425777) has the molecular formula C20H23N and a molecular weight of 277.41 g/mol. Its IUPAC name is 3-ethyl-7-methyl-6-(2-phenylethyl)-3,4-dihydroisoquinoline.
| Compound Name | 3-ethyl-7-methyl-6-(2-phenylethyl)-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 134425777 |
| Molecular Formula | C20H23N |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.18 |
| IUPAC Name | 3-ethyl-7-methyl-6-(2-phenylethyl)-3,4-dihydroisoquinoline |
| SMILES | CCC1Cc2cc(CCc3ccccc3)c(C)cc2C=N1 |
| InChI | InChI=1S/C20H23N/c1-3-20-13-18-12-17(15(2)11-19(18)14-21-20)10-9-16-7-5-4-6-8-16/h4-8,11-12,14,20H,3,9-10,13H2,1-2H3 |
| InChIKey | XUQXIYYLZJQCOG-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |