C10H12N2 — CID 76852295
4-ethyl-1,4-dihydroquinazoline (PubChem CID 76852295) has the molecular formula C10H12N2 and a molecular weight of 160.22 g/mol. Its IUPAC name is 4-ethyl-1,4-dihydroquinazoline.
| Compound Name | 4-ethyl-1,4-dihydroquinazoline |
|---|---|
| PubChem CID | 76852295 |
| Molecular Formula | C10H12N2 |
| Molecular Weight | 160.22 g/mol |
| Exact Mass | 160.10 |
| IUPAC Name | 4-ethyl-1,4-dihydroquinazoline |
| SMILES | CCC1N=CNc2ccccc21 |
| InChI | InChI=1S/C10H12N2/c1-2-9-8-5-3-4-6-10(8)12-7-11-9/h3-7,9H,2H2,1H3,(H,11,12) |
| InChIKey | NZLPYKIROACPGB-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.22 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |