C12H12ClNO3PS+ — CID 125115119
[(1R)-2-amino-1-(5-chloro-1-benzothiophen-3-yl)-2-oxoethyl]-ethoxy-oxophosphanium (PubChem CID 125115119) has the molecular formula C12H12ClNO3PS+ and a molecular weight of 316.73 g/mol. Its IUPAC name is [(1R)-2-amino-1-(5-chloro-1-benzothiophen-3-yl)-2-oxoethyl]-ethoxy-oxophosphanium.
| Compound Name | [(1R)-2-amino-1-(5-chloro-1-benzothiophen-3-yl)-2-oxoethyl]-ethoxy-oxophosphanium |
|---|---|
| PubChem CID | 125115119 |
| Molecular Formula | C12H12ClNO3PS+ |
| Molecular Weight | 316.73 g/mol |
| Exact Mass | 316.00 |
| IUPAC Name | [(1R)-2-amino-1-(5-chloro-1-benzothiophen-3-yl)-2-oxoethyl]-ethoxy-oxophosphanium |
| SMILES | CCO[P+](=O)[C@@H](C(N)=O)c1csc2ccc(Cl)cc12 |
| InChI | InChI=1S/C12H11ClNO3PS/c1-2-17-18(16)11(12(14)15)9-6-19-10-4-3-7(13)5-8(9)10/h3-6,11H,2H2,1H3,(H-,14,15)/p+1/t11-/m1/s1 |
| InChIKey | ABKSYDYPTJTYCV-LLVKDONJSA-O |
| XLogP | 3.86 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.73 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|