C14H15ClN2O3S2 — CID 87165406
methyl 3-(5-chloro-1-benzothiophen-3-yl)-2-[methylcarbamoyl(sulfanyl)amino]propanoate (PubChem CID 87165406) has the molecular formula C14H15ClN2O3S2 and a molecular weight of 358.87 g/mol. Its IUPAC name is methyl 3-(5-chloro-1-benzothiophen-3-yl)-2-[methylcarbamoyl(sulfanyl)amino]propanoate.
| Compound Name | methyl 3-(5-chloro-1-benzothiophen-3-yl)-2-[methylcarbamoyl(sulfanyl)amino]propanoate |
|---|---|
| PubChem CID | 87165406 |
| Molecular Formula | C14H15ClN2O3S2 |
| Molecular Weight | 358.87 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | methyl 3-(5-chloro-1-benzothiophen-3-yl)-2-[methylcarbamoyl(sulfanyl)amino]propanoate |
| SMILES | CNC(=O)N(S)C(Cc1csc2ccc(Cl)cc12)C(=O)OC |
| InChI | InChI=1S/C14H15ClN2O3S2/c1-16-14(19)17(21)11(13(18)20-2)5-8-7-22-12-4-3-9(15)6-10(8)12/h3-4,6-7,11,21H,5H2,1-2H3,(H,16,19) |
| InChIKey | BWEAXMLSZRIJHH-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.87 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|