C19H23N2O+ — CID 125117378
[(1R,2S)-1-(benzhydrylideneamino)-1-methylpyrrolidin-1-ium-2-yl]methanol (PubChem CID 125117378) has the molecular formula C19H23N2O+ and a molecular weight of 295.41 g/mol. Its IUPAC name is [(1R,2S)-1-(benzhydrylideneamino)-1-methylpyrrolidin-1-ium-2-yl]methanol.
| Compound Name | [(1R,2S)-1-(benzhydrylideneamino)-1-methylpyrrolidin-1-ium-2-yl]methanol |
|---|---|
| PubChem CID | 125117378 |
| Molecular Formula | C19H23N2O+ |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.18 |
| IUPAC Name | [(1R,2S)-1-(benzhydrylideneamino)-1-methylpyrrolidin-1-ium-2-yl]methanol |
| SMILES | C[N@@+]1(N=C(c2ccccc2)c2ccccc2)CCC[C@H]1CO |
| InChI | InChI=1S/C19H23N2O/c1-21(14-8-13-18(21)15-22)20-19(16-9-4-2-5-10-16)17-11-6-3-7-12-17/h2-7,9-12,18,22H,8,13-15H2,1H3/q+1/t18-,21+/m0/s1 |
| InChIKey | IKRSUAUAZHIVFK-GHTZIAJQSA-N |
| XLogP | 3.04 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|