C11H11BrClFN2O2 — CID 125141154
(3R)-N-(4-bromo-2-chloro-5-fluorophenyl)-3-hydroxypyrrolidine-1-carboxamide (PubChem CID 125141154) has the molecular formula C11H11BrClFN2O2 and a molecular weight of 337.58 g/mol. Its IUPAC name is (3R)-N-(4-bromo-2-chloro-5-fluorophenyl)-3-hydroxypyrrolidine-1-carboxamide.
| Compound Name | (3R)-N-(4-bromo-2-chloro-5-fluorophenyl)-3-hydroxypyrrolidine-1-carboxamide |
|---|---|
| PubChem CID | 125141154 |
| Molecular Formula | C11H11BrClFN2O2 |
| Molecular Weight | 337.58 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | (3R)-N-(4-bromo-2-chloro-5-fluorophenyl)-3-hydroxypyrrolidine-1-carboxamide |
| SMILES | O=C(Nc1cc(F)c(Br)cc1Cl)N1CC[C@@H](O)C1 |
| InChI | InChI=1S/C11H11BrClFN2O2/c12-7-3-8(13)10(4-9(7)14)15-11(18)16-2-1-6(17)5-16/h3-4,6,17H,1-2,5H2,(H,15,18)/t6-/m1/s1 |
| InChIKey | JUHKRACXZTVYCT-ZCFIWIBFSA-N |
| XLogP | 2.84 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.58 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|