C14H14Br2O4 — CID 125180640
CID 125180640 (PubChem CID 125180640) has the molecular formula C14H14Br2O4 and a molecular weight of 406.07 g/mol.
| Compound Name | CID 125180640 |
|---|---|
| PubChem CID | 125180640 |
| Molecular Formula | C14H14Br2O4 |
| Molecular Weight | 406.07 g/mol |
| Exact Mass | 403.93 |
| IUPAC Name | — |
| SMILES | BrC1=C[C@@H]2[C@H]3C=C[C@](Br)([C@@H]2C12OCCO2)C31OCCO1 |
| InChI | InChI=1S/C14H14Br2O4/c15-10-7-8-9-1-2-12(16,14(9)19-5-6-20-14)11(8)13(10)17-3-4-18-13/h1-2,7-9,11H,3-6H2/t8-,9-,11-,12+/m1/s1 |
| InChIKey | ISMYXJXZOODLQC-IQIPOGNMSA-N |
| XLogP | 2.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.07 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|