C14H14Br2O3 — CID 98482038
(1'R,2'R,6'R,7'S,8'R,11'R)-4',7'-dibromospiro[1,3-dioxolane-2,12'-tetracyclo[5.4.1.02,6.08,11]dodec-4-ene]-3'-one (PubChem CID 98482038) has the molecular formula C14H14Br2O3 and a molecular weight of 390.07 g/mol. Its IUPAC name is (1'R,2'R,6'R,7'S,8'R,11'R)-4',7'-dibromospiro[1,3-dioxolane-2,12'-tetracyclo[5.4.1.02,6.08,11]dodec-4-ene]-3'-one.
| Compound Name | (1'R,2'R,6'R,7'S,8'R,11'R)-4',7'-dibromospiro[1,3-dioxolane-2,12'-tetracyclo[5.4.1.02,6.08,11]dodec-4-ene]-3'-one |
|---|---|
| PubChem CID | 98482038 |
| Molecular Formula | C14H14Br2O3 |
| Molecular Weight | 390.07 g/mol |
| Exact Mass | 387.93 |
| IUPAC Name | (1'R,2'R,6'R,7'S,8'R,11'R)-4',7'-dibromospiro[1,3-dioxolane-2,12'-tetracyclo[5.4.1.02,6.08,11]dodec-4-ene]-3'-one |
| SMILES | O=C1C(Br)=C[C@H]2[C@H]1[C@H]1[C@H]3CC[C@H]3[C@@]2(Br)C12OCCO2 |
| InChI | InChI=1S/C14H14Br2O3/c15-9-5-8-10(12(9)17)11-6-1-2-7(6)13(8,16)14(11)18-3-4-19-14/h5-8,10-11H,1-4H2/t6-,7+,8-,10-,11+,13-/m0/s1 |
| InChIKey | IFVOJYBMKKNHBS-ILPJDPJPSA-N |
| XLogP | 2.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.07 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|