C9H12Cl3NSi — CID 12521902
N,N-dimethyl-1-phenyl-1-trichlorosilylmethanamine (PubChem CID 12521902) has the molecular formula C9H12Cl3NSi and a molecular weight of 268.65 g/mol. Its IUPAC name is N,N-dimethyl-1-phenyl-1-trichlorosilylmethanamine.
| Compound Name | N,N-dimethyl-1-phenyl-1-trichlorosilylmethanamine |
|---|---|
| PubChem CID | 12521902 |
| Molecular Formula | C9H12Cl3NSi |
| Molecular Weight | 268.65 g/mol |
| Exact Mass | 266.98 |
| IUPAC Name | N,N-dimethyl-1-phenyl-1-trichlorosilylmethanamine |
| SMILES | CN(C)C(c1ccccc1)[Si](Cl)(Cl)Cl |
| InChI | InChI=1S/C9H12Cl3NSi/c1-13(2)9(14(10,11)12)8-6-4-3-5-7-8/h3-7,9H,1-2H3 |
| InChIKey | XAESWCCQFZOUFB-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.65 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|