About lutetium;1-phenylethylphosphane
lutetium;1-phenylethylphosphane (PubChem CID 87744905) has the molecular formula C8H11LuP
and a molecular weight of 313.12 g/mol. Its IUPAC name is lutetium;1-phenylethylphosphane.
Molecular Properties
| Compound Name | lutetium;1-phenylethylphosphane |
| PubChem CID | 87744905 |
| Molecular Formula | C8H11LuP |
| Molecular Weight | 313.12 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | lutetium;1-phenylethylphosphane |
| SMILES | CC(P)c1ccccc1.[Lu] |
| InChI | InChI=1S/C8H11P.Lu/c1-7(9)8-5-3-2-4-6-8;/h2-7H,9H2,1H3; |
| InChIKey | BVDKBKZMBRDDKX-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.12 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze lutetium;1-phenylethylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lutetium;1-phenylethylphosphane?
The IUPAC name of lutetium;1-phenylethylphosphane (CID 87744905) is lutetium;1-phenylethylphosphane.
What is the SMILES notation for lutetium;1-phenylethylphosphane?
The canonical SMILES for lutetium;1-phenylethylphosphane is CC(P)c1ccccc1.[Lu].
What is the InChIKey of lutetium;1-phenylethylphosphane?
The InChIKey is BVDKBKZMBRDDKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11P.Lu/c1-7(9)8-5-3-2-4-6-8;/h2-7H,9H2,1H3;.
What are the key properties of lutetium;1-phenylethylphosphane?
lutetium;1-phenylethylphosphane has a molecular weight of 313.12 g/mol, XLogP of 2.62, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for lutetium;1-phenylethylphosphane is sourced from PubChem (CID 87744905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).