C16H28N4O10S2 — CID 12525954
tetrapropan-2-yl 1,4-dioxo-1,4,2,3,5,6-dithiatetrazinane-2,3,5,6-tetracarboxylate (PubChem CID 12525954) has the molecular formula C16H28N4O10S2 and a molecular weight of 500.55 g/mol. Its IUPAC name is tetrapropan-2-yl 1,4-dioxo-1,4,2,3,5,6-dithiatetrazinane-2,3,5,6-tetracarboxylate.
| Compound Name | tetrapropan-2-yl 1,4-dioxo-1,4,2,3,5,6-dithiatetrazinane-2,3,5,6-tetracarboxylate |
|---|---|
| PubChem CID | 12525954 |
| Molecular Formula | C16H28N4O10S2 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.12 |
| IUPAC Name | tetrapropan-2-yl 1,4-dioxo-1,4,2,3,5,6-dithiatetrazinane-2,3,5,6-tetracarboxylate |
| SMILES | CC(C)OC(=O)N1N(C(=O)OC(C)C)S(=O)N(C(=O)OC(C)C)N(C(=O)OC(C)C)S1=O |
| InChI | InChI=1S/C16H28N4O10S2/c1-9(2)27-13(21)17-18(14(22)28-10(3)4)32(26)20(16(24)30-12(7)8)19(31(17)25)15(23)29-11(5)6/h9-12H,1-8H3 |
| InChIKey | YOVLIBYMWIZKNI-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 152.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|