C18H22N2S — CID 125260218
(3aS,4S,8bR)-N,N-dimethyl-2-(thiophen-3-ylmethyl)-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-amine (PubChem CID 125260218) has the molecular formula C18H22N2S and a molecular weight of 298.45 g/mol. Its IUPAC name is (3aS,4S,8bR)-N,N-dimethyl-2-(thiophen-3-ylmethyl)-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-amine.
| Compound Name | (3aS,4S,8bR)-N,N-dimethyl-2-(thiophen-3-ylmethyl)-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-amine |
|---|---|
| PubChem CID | 125260218 |
| Molecular Formula | C18H22N2S |
| Molecular Weight | 298.45 g/mol |
| Exact Mass | 298.15 |
| IUPAC Name | (3aS,4S,8bR)-N,N-dimethyl-2-(thiophen-3-ylmethyl)-3,3a,4,8b-tetrahydro-1H-indeno[1,2-c]pyrrol-4-amine |
| SMILES | CN(C)[C@@H]1c2ccccc2[C@@H]2CN(Cc3ccsc3)C[C@@H]12 |
| InChI | InChI=1S/C18H22N2S/c1-19(2)18-15-6-4-3-5-14(15)16-10-20(11-17(16)18)9-13-7-8-21-12-13/h3-8,12,16-18H,9-11H2,1-2H3/t16-,17+,18+/m0/s1 |
| InChIKey | PGRQITFCFUKSNX-RCCFBDPRSA-N |
| XLogP | 3.58 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.45 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |