C10H22Si — CID 12533415
trimethyl-[(E)-2,3,3-trimethylbut-1-enyl]silane (PubChem CID 12533415) has the molecular formula C10H22Si and a molecular weight of 170.37 g/mol. Its IUPAC name is trimethyl-[(E)-2,3,3-trimethylbut-1-enyl]silane.
| Compound Name | trimethyl-[(E)-2,3,3-trimethylbut-1-enyl]silane |
|---|---|
| PubChem CID | 12533415 |
| Molecular Formula | C10H22Si |
| Molecular Weight | 170.37 g/mol |
| Exact Mass | 170.15 |
| IUPAC Name | trimethyl-[(E)-2,3,3-trimethylbut-1-enyl]silane |
| SMILES | C/C(=C\[Si](C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C10H22Si/c1-9(10(2,3)4)8-11(5,6)7/h8H,1-7H3/b9-8+ |
| InChIKey | ZKAIUJSRWXQWIE-CMDGGOBGSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.37 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|