C17H22N2O3 — CID 125418879
cis-(1R,2R)-2-[(3S)-4-(1,3-benzoxazol-2-yl)morpholin-3-yl]cyclohexan-1-ol (PubChem CID 125418879) has the molecular formula C17H22N2O3 and a molecular weight of 302.37 g/mol. Its IUPAC name is cis-(1R,2R)-2-[(3S)-4-(1,3-benzoxazol-2-yl)morpholin-3-yl]cyclohexan-1-ol.
| Compound Name | cis-(1R,2R)-2-[(3S)-4-(1,3-benzoxazol-2-yl)morpholin-3-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 125418879 |
| Molecular Formula | C17H22N2O3 |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | cis-(1R,2R)-2-[(3S)-4-(1,3-benzoxazol-2-yl)morpholin-3-yl]cyclohexan-1-ol |
| SMILES | O[C@@H]1CCCC[C@@H]1[C@H]1COCCN1c1nc2ccccc2o1 |
| InChI | InChI=1S/C17H22N2O3/c20-15-7-3-1-5-12(15)14-11-21-10-9-19(14)17-18-13-6-2-4-8-16(13)22-17/h2,4,6,8,12,14-15,20H,1,3,5,7,9-11H2/t12-,14-,15-/m1/s1 |
| InChIKey | GGYFOSBFZYEGHC-BPLDGKMQSA-N |
| XLogP | 2.58 |
| TPSA | 58.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |