C15H22N4O — CID 125435082
N-[(1S)-1-(cyclohexen-1-yl)ethyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxamide (PubChem CID 125435082) has the molecular formula C15H22N4O and a molecular weight of 274.37 g/mol. Its IUPAC name is N-[(1S)-1-(cyclohexen-1-yl)ethyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxamide.
| Compound Name | N-[(1S)-1-(cyclohexen-1-yl)ethyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxamide |
|---|---|
| PubChem CID | 125435082 |
| Molecular Formula | C15H22N4O |
| Molecular Weight | 274.37 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | N-[(1S)-1-(cyclohexen-1-yl)ethyl]-3,4,6,7-tetrahydroimidazo[4,5-c]pyridine-5-carboxamide |
| SMILES | C[C@H](NC(=O)N1CCc2nc[nH]c2C1)C1=CCCCC1 |
| InChI | InChI=1S/C15H22N4O/c1-11(12-5-3-2-4-6-12)18-15(20)19-8-7-13-14(9-19)17-10-16-13/h5,10-11H,2-4,6-9H2,1H3,(H,16,17)(H,18,20)/t11-/m0/s1 |
| InChIKey | WMQMKUAGARVULB-NSHDSACASA-N |
| XLogP | 2.37 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|