C21H25N5O2 — CID 125447810
N-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[6-(ethylamino)pyridazin-3-yl]benzamide (PubChem CID 125447810) has the molecular formula C21H25N5O2 and a molecular weight of 379.46 g/mol. Its IUPAC name is N-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[6-(ethylamino)pyridazin-3-yl]benzamide.
| Compound Name | N-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[6-(ethylamino)pyridazin-3-yl]benzamide |
|---|---|
| PubChem CID | 125447810 |
| Molecular Formula | C21H25N5O2 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.20 |
| IUPAC Name | N-[(2R)-2-(dimethylamino)-2-(furan-2-yl)ethyl]-3-[6-(ethylamino)pyridazin-3-yl]benzamide |
| SMILES | CCNc1ccc(-c2cccc(C(=O)NC[C@H](c3ccco3)N(C)C)c2)nn1 |
| InChI | InChI=1S/C21H25N5O2/c1-4-22-20-11-10-17(24-25-20)15-7-5-8-16(13-15)21(27)23-14-18(26(2)3)19-9-6-12-28-19/h5-13,18H,4,14H2,1-3H3,(H,22,25)(H,23,27)/t18-/m1/s1 |
| InChIKey | ULKAOCLORZRCDZ-GOSISDBHSA-N |
| XLogP | 3.20 |
| TPSA | 83.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |