C12H18N2O — CID 125449895
(2R,4R,6R)-1,6-dimethyl-4-pyridin-3-ylpiperidin-2-ol (PubChem CID 125449895) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is (2R,4R,6R)-1,6-dimethyl-4-pyridin-3-ylpiperidin-2-ol.
| Compound Name | (2R,4R,6R)-1,6-dimethyl-4-pyridin-3-ylpiperidin-2-ol |
|---|---|
| PubChem CID | 125449895 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | (2R,4R,6R)-1,6-dimethyl-4-pyridin-3-ylpiperidin-2-ol |
| SMILES | C[C@@H]1C[C@@H](c2cccnc2)C[C@@H](O)N1C |
| InChI | InChI=1S/C12H18N2O/c1-9-6-11(7-12(15)14(9)2)10-4-3-5-13-8-10/h3-5,8-9,11-12,15H,6-7H2,1-2H3/t9-,11-,12-/m1/s1 |
| InChIKey | OGEIGZGUZIRJPN-YUSALJHKSA-N |
| XLogP | 1.60 |
| TPSA | 36.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |