C11H16N2O3 — CID 125454590
4-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-ol (PubChem CID 125454590) has the molecular formula C11H16N2O3 and a molecular weight of 224.26 g/mol. Its IUPAC name is 4-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-ol.
| Compound Name | 4-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-ol |
|---|---|
| PubChem CID | 125454590 |
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.26 g/mol |
| Exact Mass | 224.12 |
| IUPAC Name | 4-[(3-cyclopropyl-1,2,4-oxadiazol-5-yl)methyl]oxan-4-ol |
| SMILES | OC1(Cc2nc(C3CC3)no2)CCOCC1 |
| InChI | InChI=1S/C11H16N2O3/c14-11(3-5-15-6-4-11)7-9-12-10(13-16-9)8-1-2-8/h8,14H,1-7H2 |
| InChIKey | UDWSJWSYHGEDRG-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 68.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.26 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |