C19H23N3O2Si — CID 125465636
(2S)-2-amino-N-(3-cyano-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide (PubChem CID 125465636) has the molecular formula C19H23N3O2Si and a molecular weight of 353.50 g/mol. Its IUPAC name is (2S)-2-amino-N-(3-cyano-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide.
| Compound Name | (2S)-2-amino-N-(3-cyano-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 125465636 |
| Molecular Formula | C19H23N3O2Si |
| Molecular Weight | 353.50 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | (2S)-2-amino-N-(3-cyano-4-trimethylsilylphenyl)-2-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc([C@H](N)C(=O)Nc2ccc([Si](C)(C)C)c(C#N)c2)cc1 |
| InChI | InChI=1S/C19H23N3O2Si/c1-24-16-8-5-13(6-9-16)18(21)19(23)22-15-7-10-17(25(2,3)4)14(11-15)12-20/h5-11,18H,21H2,1-4H3,(H,22,23)/t18-/m0/s1 |
| InChIKey | CMUPNMCTQPUMKF-SFHVURJKSA-N |
| XLogP | 2.75 |
| TPSA | 88.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|