3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride

C14H17ClO3S — CID 125469505

IUPAC3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride
SMILESCc1c(C(=O)Cl)ccc(C(C)C)c1S(=O)(=O)C1CC1
InChIInChI=1S/C14H17ClO3S/c1-8(2)11-6-7-12(14(15)16)9(3)13(11)19(17,18)10-4-5-10/h6-8,10H,4-5H2,1-3H3
InChIKeyZQPCGQSBUWFWLZ-UHFFFAOYSA-N
MW300.81 g/mol
LogP3.43
Rot. Bonds4

About 3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride

3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride (PubChem CID 125469505) has the molecular formula C14H17ClO3S and a molecular weight of 300.81 g/mol. Its IUPAC name is 3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride.

Molecular Properties

Compound Name3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride
PubChem CID125469505
Molecular FormulaC14H17ClO3S
Molecular Weight300.81 g/mol
Exact Mass300.06
IUPAC Name3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride
SMILESCc1c(C(=O)Cl)ccc(C(C)C)c1S(=O)(=O)C1CC1
InChIInChI=1S/C14H17ClO3S/c1-8(2)11-6-7-12(14(15)16)9(3)13(11)19(17,18)10-4-5-10/h6-8,10H,4-5H2,1-3H3
InChIKeyZQPCGQSBUWFWLZ-UHFFFAOYSA-N
XLogP3.43
TPSA51.21 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds4
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500300.81
LogP ≤ 53.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride?
The IUPAC name of 3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride (CID 125469505) is 3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride.
What is the SMILES notation for 3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride?
The canonical SMILES for 3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride is Cc1c(C(=O)Cl)ccc(C(C)C)c1S(=O)(=O)C1CC1.
What is the InChIKey of 3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride?
The InChIKey is ZQPCGQSBUWFWLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17ClO3S/c1-8(2)11-6-7-12(14(15)16)9(3)13(11)19(17,18)10-4-5-10/h6-8,10H,4-5H2,1-3H3.
What are the key properties of 3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride?
3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride has a molecular weight of 300.81 g/mol, XLogP of 3.43, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropylsulfonyl-2-methyl-4-propan-2-ylbenzoyl chloride is sourced from PubChem (CID 125469505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).