C12H25NOS — CID 125475737
(R)-N-[(3R,4S)-2,4-dimethylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide (PubChem CID 125475737) has the molecular formula C12H25NOS and a molecular weight of 231.40 g/mol. Its IUPAC name is (R)-N-[(3R,4S)-2,4-dimethylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide.
| Compound Name | (R)-N-[(3R,4S)-2,4-dimethylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide |
|---|---|
| PubChem CID | 125475737 |
| Molecular Formula | C12H25NOS |
| Molecular Weight | 231.40 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | (R)-N-[(3R,4S)-2,4-dimethylhex-5-en-3-yl]-2-methylpropane-2-sulfinamide |
| SMILES | C=C[C@H](C)[C@H](N[S@](=O)C(C)(C)C)C(C)C |
| InChI | InChI=1S/C12H25NOS/c1-8-10(4)11(9(2)3)13-15(14)12(5,6)7/h8-11,13H,1H2,2-7H3/t10-,11+,15+/m0/s1 |
| InChIKey | KXDCGZHLLFHUTG-FIXISWKDSA-N |
| XLogP | 2.88 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.40 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|