C11H14N2O2 — CID 125478275
(3S)-8-amino-7-methoxy-3-methyl-3,4-dihydro-2H-isoquinolin-1-one (PubChem CID 125478275) has the molecular formula C11H14N2O2 and a molecular weight of 206.24 g/mol. Its IUPAC name is (3S)-8-amino-7-methoxy-3-methyl-3,4-dihydro-2H-isoquinolin-1-one.
| Compound Name | (3S)-8-amino-7-methoxy-3-methyl-3,4-dihydro-2H-isoquinolin-1-one |
|---|---|
| PubChem CID | 125478275 |
| Molecular Formula | C11H14N2O2 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.11 |
| IUPAC Name | (3S)-8-amino-7-methoxy-3-methyl-3,4-dihydro-2H-isoquinolin-1-one |
| SMILES | COc1ccc2c(c1N)C(=O)N[C@@H](C)C2 |
| InChI | InChI=1S/C11H14N2O2/c1-6-5-7-3-4-8(15-2)10(12)9(7)11(14)13-6/h3-4,6H,5,12H2,1-2H3,(H,13,14)/t6-/m0/s1 |
| InChIKey | WHQFYHLLUKQRQZ-LURJTMIESA-N |
| XLogP | 0.95 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|