C10H9NO4 — CID 178110016
5-methoxy-3-oxo-1,2-dihydroisoindole-4-carboxylic acid (PubChem CID 178110016) has the molecular formula C10H9NO4 and a molecular weight of 207.19 g/mol. Its IUPAC name is 5-methoxy-3-oxo-1,2-dihydroisoindole-4-carboxylic acid.
| Compound Name | 5-methoxy-3-oxo-1,2-dihydroisoindole-4-carboxylic acid |
|---|---|
| PubChem CID | 178110016 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 5-methoxy-3-oxo-1,2-dihydroisoindole-4-carboxylic acid |
| SMILES | COc1ccc2c(c1C(=O)O)C(=O)NC2 |
| InChI | InChI=1S/C10H9NO4/c1-15-6-3-2-5-4-11-9(12)7(5)8(6)10(13)14/h2-3H,4H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | XQZWBUNXEZUGLX-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |